![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Wiley-Computational...> | 2015-10-10 16:15 | 4.6M | |
| Jensen F. Introducti..> | 2015-10-10 15:48 | 4.9M | |
| Introduction_to_Comp..> | 2015-10-10 15:48 | 5.0M | |
| Molecular modelling ..> | 2015-10-10 15:48 | 5.6M | |
| Essentials_of_comput..> | 2015-10-10 15:47 | 6.9M | |
| Essentials of comput..> | 2015-10-10 16:15 | 7.2M | |
| Jensen_Introduction ..> | 2015-10-10 16:15 | 9.9M | |
| Quimica cuantica 5ed..> | 2015-10-10 16:15 | 10M | |
| J.B.Foresman,A.Frisc..> | 2015-10-10 15:47 | 12M | |
| molecular_quantum_me..> | 2015-10-10 15:48 | 15M | |
| Molecular Driving Fo..> | 2015-10-10 15:48 | 15M | |
| The molecular modeli..> | 2015-10-10 15:48 | 27M | |