![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Water vaporization a..> | 2017-03-08 16:33 | 14M | |
| Thumbs.db | 2017-03-08 16:33 | 49K | |
| Oil and water separa..> | 2017-03-08 16:33 | 13M | |
| Moving atoms _ Átomo..> | 2017-03-08 16:33 | 2.2M | |
| Molecular dynamics s..> | 2017-03-08 16:33 | 4.1M | |
| Molecular Dynamics S..> | 2017-03-08 16:33 | 13M | |
| Molecular Dynamics -..> | 2017-03-08 16:33 | 13M | |
| MD in 1st excited st..> | 2017-03-08 16:32 | 469K | |
| Graban el comportami..> | 2017-03-08 16:32 | 6.5M | |
| An Introduction to M..> | 2017-03-08 16:33 | 62M | |